C11H6F6N4 — CID 114564923
6-(trifluoromethyl)-4-N-(2,3,5-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 114564923) has the molecular formula C11H6F6N4 and a molecular weight of 308.19 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4-N-(2,3,5-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(trifluoromethyl)-4-N-(2,3,5-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114564923 |
| Molecular Formula | C11H6F6N4 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 6-(trifluoromethyl)-4-N-(2,3,5-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2cc(F)cc(F)c2F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H6F6N4/c12-4-1-5(13)9(14)6(2-4)19-8-3-7(11(15,16)17)20-10(18)21-8/h1-3H,(H3,18,19,20,21) |
| InChIKey | QCFZZDYPZGEDCC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|