C13H19N5O — CID 114570663
2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]pentanenitrile (PubChem CID 114570663) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]pentanenitrile.
| Compound Name | 2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 114570663 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]pentanenitrile |
| SMILES | CCCC(C#N)N1CCN(c2ncc[nH]c2=O)CC1 |
| InChI | InChI=1S/C13H19N5O/c1-2-3-11(10-14)17-6-8-18(9-7-17)12-13(19)16-5-4-15-12/h4-5,11H,2-3,6-9H2,1H3,(H,16,19) |
| InChIKey | WEKITLRSVJGDTL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |