C13H20N6O — CID 136973053
2-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]pentanenitrile (PubChem CID 136973053) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]pentanenitrile.
| Compound Name | 2-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 136973053 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[4-(5-amino-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]pentanenitrile |
| SMILES | CCCC(C#N)N1CCN(c2nc[nH]c(=O)c2N)CC1 |
| InChI | InChI=1S/C13H20N6O/c1-2-3-10(8-14)18-4-6-19(7-5-18)12-11(15)13(20)17-9-16-12/h9-10H,2-7,15H2,1H3,(H,16,17,20) |
| InChIKey | UZEAAPPXIDKSTE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |