C15H19N5S — CID 63343858
2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)pentanenitrile (PubChem CID 63343858) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)pentanenitrile.
| Compound Name | 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)pentanenitrile |
|---|---|
| PubChem CID | 63343858 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)pentanenitrile |
| SMILES | CCCC(C#N)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C15H19N5S/c1-2-3-12(10-16)19-5-7-20(8-6-19)14-13-4-9-21-15(13)18-11-17-14/h4,9,11-12H,2-3,5-8H2,1H3 |
| InChIKey | DARDNQPNLXJBAL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |