C6H6ClF2N3O — CID 114582648
5-amino-6-chloro-3-(2,2-difluoroethyl)pyrimidin-4-one (PubChem CID 114582648) has the molecular formula C6H6ClF2N3O and a molecular weight of 209.58 g/mol. Its IUPAC name is 5-amino-6-chloro-3-(2,2-difluoroethyl)pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-(2,2-difluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582648 |
| Molecular Formula | C6H6ClF2N3O |
| Molecular Weight | 209.58 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 5-amino-6-chloro-3-(2,2-difluoroethyl)pyrimidin-4-one |
| SMILES | Nc1c(Cl)ncn(CC(F)F)c1=O |
| InChI | InChI=1S/C6H6ClF2N3O/c7-5-4(10)6(13)12(2-11-5)1-3(8)9/h2-3H,1,10H2 |
| InChIKey | IIUQWNNZTWBFGH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.58 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |