C8H9ClF3N3O — CID 114582585
5-amino-6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (PubChem CID 114582585) has the molecular formula C8H9ClF3N3O and a molecular weight of 255.63 g/mol. Its IUPAC name is 5-amino-6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 114582585 |
| Molecular Formula | C8H9ClF3N3O |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-amino-6-chloro-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| SMILES | Nc1c(Cl)ncn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H9ClF3N3O/c9-6-5(13)7(16)15(4-14-6)3-1-2-8(10,11)12/h4H,1-3,13H2 |
| InChIKey | DCPLAJWRJZBPNV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |