C9H11ClF3N3O2 — CID 114582508
5-amino-6-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one (PubChem CID 114582508) has the molecular formula C9H11ClF3N3O2 and a molecular weight of 285.65 g/mol. Its IUPAC name is 5-amino-6-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114582508 |
| Molecular Formula | C9H11ClF3N3O2 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5-amino-6-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
| SMILES | Nc1c(Cl)ncn(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11ClF3N3O2/c10-7-6(14)8(17)16(5-15-7)2-1-3-18-4-9(11,12)13/h5H,1-4,14H2 |
| InChIKey | CXBPWDZEDUHAIJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|