C9H9ClF3IN2O2 — CID 114583791
6-chloro-5-iodo-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one (PubChem CID 114583791) has the molecular formula C9H9ClF3IN2O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 6-chloro-5-iodo-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one.
| Compound Name | 6-chloro-5-iodo-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114583791 |
| Molecular Formula | C9H9ClF3IN2O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 6-chloro-5-iodo-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidin-4-one |
| SMILES | O=c1c(I)c(Cl)ncn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3IN2O2/c10-7-6(14)8(17)16(5-15-7)2-1-3-18-4-9(11,12)13/h5H,1-4H2 |
| InChIKey | IDJQQDVQIWAOJE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|