C8H9ClF3N3O2 — CID 114582847
5-amino-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 114582847) has the molecular formula C8H9ClF3N3O2 and a molecular weight of 271.63 g/mol. Its IUPAC name is 5-amino-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 5-amino-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114582847 |
| Molecular Formula | C8H9ClF3N3O2 |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5-amino-6-chloro-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | Nc1c(Cl)ncn(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H9ClF3N3O2/c9-6-5(13)7(16)15(4-14-6)1-2-17-3-8(10,11)12/h4H,1-3,13H2 |
| InChIKey | IGSBDYUJGCNULM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|