C9H11Cl2N3O3 — CID 114582908
2-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 114582908) has the molecular formula C9H11Cl2N3O3 and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 114582908 |
| Molecular Formula | C9H11Cl2N3O3 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyrimidin-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H11Cl2N3O3/c1-17-3-2-12-6(15)4-14-5-13-8(11)7(10)9(14)16/h5H,2-4H2,1H3,(H,12,15) |
| InChIKey | FMJPNCJCHQZKCF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|