C10H11Cl2N3O2 — CID 114583208
3-(4,5-dichloro-6-oxopyrimidin-1-yl)azepan-2-one (PubChem CID 114583208) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-(4,5-dichloro-6-oxopyrimidin-1-yl)azepan-2-one.
| Compound Name | 3-(4,5-dichloro-6-oxopyrimidin-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 114583208 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-(4,5-dichloro-6-oxopyrimidin-1-yl)azepan-2-one |
| SMILES | O=C1NCCCCC1n1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H11Cl2N3O2/c11-7-8(12)14-5-15(10(7)17)6-3-1-2-4-13-9(6)16/h5-6H,1-4H2,(H,13,16) |
| InChIKey | VPDWQRVAGRZJPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |