C16H15ClN2S — CID 114590391
4-chloro-2-(3-ethylthiophen-2-yl)-6,8-dimethylquinazoline (PubChem CID 114590391) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 4-chloro-2-(3-ethylthiophen-2-yl)-6,8-dimethylquinazoline.
| Compound Name | 4-chloro-2-(3-ethylthiophen-2-yl)-6,8-dimethylquinazoline |
|---|---|
| PubChem CID | 114590391 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-chloro-2-(3-ethylthiophen-2-yl)-6,8-dimethylquinazoline |
| SMILES | CCc1ccsc1-c1nc(Cl)c2cc(C)cc(C)c2n1 |
| InChI | InChI=1S/C16H15ClN2S/c1-4-11-5-6-20-14(11)16-18-13-10(3)7-9(2)8-12(13)15(17)19-16/h5-8H,4H2,1-3H3 |
| InChIKey | WQKZXRUGINQOFH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |