C18H17ClN2 — CID 114591032
4-chloro-2-(2,4-dimethylphenyl)-8-ethylquinazoline (PubChem CID 114591032) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dimethylphenyl)-8-ethylquinazoline.
| Compound Name | 4-chloro-2-(2,4-dimethylphenyl)-8-ethylquinazoline |
|---|---|
| PubChem CID | 114591032 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-chloro-2-(2,4-dimethylphenyl)-8-ethylquinazoline |
| SMILES | CCc1cccc2c(Cl)nc(-c3ccc(C)cc3C)nc12 |
| InChI | InChI=1S/C18H17ClN2/c1-4-13-6-5-7-15-16(13)20-18(21-17(15)19)14-9-8-11(2)10-12(14)3/h5-10H,4H2,1-3H3 |
| InChIKey | SUUUMMFNSWNFKL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |