C14H10Cl2N2OS — CID 114590837
4,8-dichloro-2-(4-methoxythiophen-2-yl)-6-methylquinazoline (PubChem CID 114590837) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is 4,8-dichloro-2-(4-methoxythiophen-2-yl)-6-methylquinazoline.
| Compound Name | 4,8-dichloro-2-(4-methoxythiophen-2-yl)-6-methylquinazoline |
|---|---|
| PubChem CID | 114590837 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 4,8-dichloro-2-(4-methoxythiophen-2-yl)-6-methylquinazoline |
| SMILES | COc1csc(-c2nc(Cl)c3cc(C)cc(Cl)c3n2)c1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c1-7-3-9-12(10(15)4-7)17-14(18-13(9)16)11-5-8(19-2)6-20-11/h3-6H,1-2H3 |
| InChIKey | BQZFQJIEXMIMKU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |