C18H21N — CID 11459393
(1R,4S)-1,2,4-trimethyl-4-phenyl-1,3-dihydroisoquinoline (PubChem CID 11459393) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (1R,4S)-1,2,4-trimethyl-4-phenyl-1,3-dihydroisoquinoline.
| Compound Name | (1R,4S)-1,2,4-trimethyl-4-phenyl-1,3-dihydroisoquinoline |
|---|---|
| PubChem CID | 11459393 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (1R,4S)-1,2,4-trimethyl-4-phenyl-1,3-dihydroisoquinoline |
| SMILES | C[C@@H]1c2ccccc2[C@](C)(c2ccccc2)CN1C |
| InChI | InChI=1S/C18H21N/c1-14-16-11-7-8-12-17(16)18(2,13-19(14)3)15-9-5-4-6-10-15/h4-12,14H,13H2,1-3H3/t14-,18+/m1/s1 |
| InChIKey | REOVCYGVDFWMKV-KDOFPFPSSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |