C19H31NO — CID 114596237
1-(4-ethylphenyl)-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-ol (PubChem CID 114596237) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-ol.
| Compound Name | 1-(4-ethylphenyl)-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 114596237 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-ol |
| SMILES | CCc1ccc(C(O)C(C)N2CC(C)CC(C)C2C)cc1 |
| InChI | InChI=1S/C19H31NO/c1-6-17-7-9-18(10-8-17)19(21)16(5)20-12-13(2)11-14(3)15(20)4/h7-10,13-16,19,21H,6,11-12H2,1-5H3 |
| InChIKey | ZQYDDZUZUVKYRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |