C17H20O2 — CID 63893193
(4-ethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol (PubChem CID 63893193) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (4-ethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol.
| Compound Name | (4-ethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol |
|---|---|
| PubChem CID | 63893193 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (4-ethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol |
| SMILES | CCc1ccc(C(O)c2ccc(C3CC3C)o2)cc1 |
| InChI | InChI=1S/C17H20O2/c1-3-12-4-6-13(7-5-12)17(18)16-9-8-15(19-16)14-10-11(14)2/h4-9,11,14,17-18H,3,10H2,1-2H3 |
| InChIKey | BTOTYSXBGFWSTN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |