C16H24O3 — CID 11459748
(1S,2R,4S,5R)-1-[(1S,2S)-2-methoxycyclohexyl]-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11459748) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1S,2R,4S,5R)-1-[(1S,2S)-2-methoxycyclohexyl]-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,4S,5R)-1-[(1S,2S)-2-methoxycyclohexyl]-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11459748 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1S,2R,4S,5R)-1-[(1S,2S)-2-methoxycyclohexyl]-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CO[C@H]1CCCC[C@@H]1[C@]12C=C[C@@H](O1)[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C16H24O3/c1-10-13-8-9-16(19-13,11(2)15(10)17)12-6-4-5-7-14(12)18-3/h8-14H,4-7H2,1-3H3/t10-,11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | MOWMAZABHWASQJ-SFYOKDCNSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|