C12H20O2Sn — CID 177494688
(1S,2S,4S,5R)-2,4-dimethyl-1-trimethylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 177494688) has the molecular formula C12H20O2Sn and a molecular weight of 315.00 g/mol. Its IUPAC name is (1S,2S,4S,5R)-2,4-dimethyl-1-trimethylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2S,4S,5R)-2,4-dimethyl-1-trimethylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 177494688 |
| Molecular Formula | C12H20O2Sn |
| Molecular Weight | 315.00 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (1S,2S,4S,5R)-2,4-dimethyl-1-trimethylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@]2([Sn](C)(C)C)C=C[C@H]1O2 |
| InChI | InChI=1S/C9H11O2.3CH3.Sn/c1-5-7-3-4-8(11-7)6(2)9(5)10;;;;/h3-7H,1-2H3;3*1H3;/t5-,6+,7+;;;;/m0..../s1 |
| InChIKey | VQUSSHIXZVMVDB-YYWCTZDQSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.00 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|