C12H18O3 — CID 25140882
(1S,2S,4R,5S)-7-(methoxymethyl)-1,2,4-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 25140882) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1S,2S,4R,5S)-7-(methoxymethyl)-1,2,4-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2S,4R,5S)-7-(methoxymethyl)-1,2,4-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 25140882 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1S,2S,4R,5S)-7-(methoxymethyl)-1,2,4-trimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | COCC1=C[C@@H]2O[C@@]1(C)[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C12H18O3/c1-7-10-5-9(6-14-4)12(3,15-10)8(2)11(7)13/h5,7-8,10H,6H2,1-4H3/t7-,8-,10+,12+/m1/s1 |
| InChIKey | FGGPLTCKXGCUAY-LBRZWBMMSA-N |
| XLogP | 1.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|