C18H19BrO — CID 114601521
(4-bromo-3-methylphenyl)-(2-cyclobutylphenyl)methanol (PubChem CID 114601521) has the molecular formula C18H19BrO and a molecular weight of 331.25 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl)-(2-cyclobutylphenyl)methanol.
| Compound Name | (4-bromo-3-methylphenyl)-(2-cyclobutylphenyl)methanol |
|---|---|
| PubChem CID | 114601521 |
| Molecular Formula | C18H19BrO |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (4-bromo-3-methylphenyl)-(2-cyclobutylphenyl)methanol |
| SMILES | Cc1cc(C(O)c2ccccc2C2CCC2)ccc1Br |
| InChI | InChI=1S/C18H19BrO/c1-12-11-14(9-10-17(12)19)18(20)16-8-3-2-7-15(16)13-5-4-6-13/h2-3,7-11,13,18,20H,4-6H2,1H3 |
| InChIKey | CGVHUMFMNJGIJS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |