C17H20O2 — CID 115838610
(2-cyclobutylphenyl)-(2,5-dimethylfuran-3-yl)methanol (PubChem CID 115838610) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(2,5-dimethylfuran-3-yl)methanol.
| Compound Name | (2-cyclobutylphenyl)-(2,5-dimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 115838610 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2-cyclobutylphenyl)-(2,5-dimethylfuran-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccccc2C2CCC2)c(C)o1 |
| InChI | InChI=1S/C17H20O2/c1-11-10-16(12(2)19-11)17(18)15-9-4-3-8-14(15)13-6-5-7-13/h3-4,8-10,13,17-18H,5-7H2,1-2H3 |
| InChIKey | XALOIHLRQUPKCI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |