C19H24OS — CID 114601532
(5-tert-butylthiophen-2-yl)-(2-cyclobutylphenyl)methanol (PubChem CID 114601532) has the molecular formula C19H24OS and a molecular weight of 300.47 g/mol. Its IUPAC name is (5-tert-butylthiophen-2-yl)-(2-cyclobutylphenyl)methanol.
| Compound Name | (5-tert-butylthiophen-2-yl)-(2-cyclobutylphenyl)methanol |
|---|---|
| PubChem CID | 114601532 |
| Molecular Formula | C19H24OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (5-tert-butylthiophen-2-yl)-(2-cyclobutylphenyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)c2ccccc2C2CCC2)s1 |
| InChI | InChI=1S/C19H24OS/c1-19(2,3)17-12-11-16(21-17)18(20)15-10-5-4-9-14(15)13-7-6-8-13/h4-5,9-13,18,20H,6-8H2,1-3H3 |
| InChIKey | BJGJJIFABYEBLZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |