C13H12INO4 — CID 114603752
1-(3,5-dimethoxyphenyl)-4-iodopyrrole-2-carboxylic acid (PubChem CID 114603752) has the molecular formula C13H12INO4 and a molecular weight of 373.15 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-4-iodopyrrole-2-carboxylic acid.
| Compound Name | 1-(3,5-dimethoxyphenyl)-4-iodopyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114603752 |
| Molecular Formula | C13H12INO4 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-4-iodopyrrole-2-carboxylic acid |
| SMILES | COc1cc(OC)cc(-n2cc(I)cc2C(=O)O)c1 |
| InChI | InChI=1S/C13H12INO4/c1-18-10-4-9(5-11(6-10)19-2)15-7-8(14)3-12(15)13(16)17/h3-7H,1-2H3,(H,16,17) |
| InChIKey | DXKPNPCRVZAUSK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|