About 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid
4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid (PubChem CID 114605321) has the molecular formula C8H7ClF3NO2
and a molecular weight of 241.60 g/mol. Its IUPAC name is 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid.
Analyze 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid?
The IUPAC name of 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid (CID 114605321) is 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid?
The canonical SMILES for 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid is O=C(O)c1cc(Cl)cn1CCC(F)(F)F.
What is the InChIKey of 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid?
The InChIKey is SCCALEXNMAZYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF3NO2/c9-5-3-6(7(14)15)13(4-5)2-1-8(10,11)12/h3-4H,1-2H2,(H,14,15).
What are the key properties of 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid?
4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid has a molecular weight of 241.60 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(3,3,3-trifluoropropyl)pyrrole-2-carboxylic acid is sourced from PubChem (CID 114605321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).