C11H12ClN3O2 — CID 114606546
4-chloro-1-(3-pyrazol-1-ylpropyl)pyrrole-2-carboxylic acid (PubChem CID 114606546) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 4-chloro-1-(3-pyrazol-1-ylpropyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-chloro-1-(3-pyrazol-1-ylpropyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606546 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 4-chloro-1-(3-pyrazol-1-ylpropyl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cn1CCCn1cccn1 |
| InChI | InChI=1S/C11H12ClN3O2/c12-9-7-10(11(16)17)14(8-9)4-2-6-15-5-1-3-13-15/h1,3,5,7-8H,2,4,6H2,(H,16,17) |
| InChIKey | OUUMHFGNTCPIFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |