C12H18N2 — CID 114605625
N'-(2-cyclobutylphenyl)ethane-1,2-diamine (PubChem CID 114605625) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-(2-cyclobutylphenyl)ethane-1,2-diamine.
| Compound Name | N'-(2-cyclobutylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114605625 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-(2-cyclobutylphenyl)ethane-1,2-diamine |
| SMILES | NCCNc1ccccc1C1CCC1 |
| InChI | InChI=1S/C12H18N2/c13-8-9-14-12-7-2-1-6-11(12)10-4-3-5-10/h1-2,6-7,10,14H,3-5,8-9,13H2 |
| InChIKey | UCZYTXXFYZHVCF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |