C17H30O2Si — CID 11460617
2-[(2R,6R)-2-[(2S)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde (PubChem CID 11460617) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-[(2R,6R)-2-[(2S)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,6R)-2-[(2S)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 11460617 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-[(2R,6R)-2-[(2S)-2-methyl-4-(trimethylsilylmethyl)pent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]acetaldehyde |
| SMILES | C=C(C[C@H](C)C[C@@H]1CC=C[C@@H](CC=O)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C17H30O2Si/c1-14(11-15(2)13-20(3,4)5)12-17-8-6-7-16(19-17)9-10-18/h6-7,10,14,16-17H,2,8-9,11-13H2,1,3-5H3/t14-,16-,17-/m0/s1 |
| InChIKey | GEDHVIUOYDTQGB-XIRDDKMYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|