C10H22N2O2 — CID 114616213
4,4-dimethoxy-2-N-(2-methylprop-2-enyl)butane-1,2-diamine (PubChem CID 114616213) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4,4-dimethoxy-2-N-(2-methylprop-2-enyl)butane-1,2-diamine.
| Compound Name | 4,4-dimethoxy-2-N-(2-methylprop-2-enyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 114616213 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4,4-dimethoxy-2-N-(2-methylprop-2-enyl)butane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)CC(OC)OC |
| InChI | InChI=1S/C10H22N2O2/c1-8(2)7-12-9(6-11)5-10(13-3)14-4/h9-10,12H,1,5-7,11H2,2-4H3 |
| InChIKey | WEWBPFOHAGHHMY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|