C19H27NO — CID 114619764
6-cyclohex-2-en-1-yloxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 114619764) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 6-cyclohex-2-en-1-yloxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 6-cyclohex-2-en-1-yloxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 114619764 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 6-cyclohex-2-en-1-yloxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCCNC1CCCc2cc(OC3C=CCCC3)ccc21 |
| InChI | InChI=1S/C19H27NO/c1-2-13-20-19-10-6-7-15-14-17(11-12-18(15)19)21-16-8-4-3-5-9-16/h4,8,11-12,14,16,19-20H,2-3,5-7,9-10,13H2,1H3 |
| InChIKey | ZGHRQFSWXVLLAO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|