C17H26O7 — CID 11461997
methyl 2-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]prop-2-enoate (PubChem CID 11461997) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is methyl 2-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]prop-2-enoate.
| Compound Name | methyl 2-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]prop-2-enoate |
|---|---|
| PubChem CID | 11461997 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl 2-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]prop-2-enoate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1[C@H](OC(=C)C(=O)OC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H26O7/c1-8-11-14(24-17(5,6)22-11)13(21-10(2)15(18)19-7)12-9-20-16(3,4)23-12/h8,11-14H,1-2,9H2,3-7H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | HYTIWPMAJDXOHM-AAVRWANBSA-N |
| XLogP | 1.92 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|