C13H24O2 — CID 114621793
3-(2,2,5,5-tetramethyloxolan-3-yl)pentan-2-one (PubChem CID 114621793) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 3-(2,2,5,5-tetramethyloxolan-3-yl)pentan-2-one.
| Compound Name | 3-(2,2,5,5-tetramethyloxolan-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 114621793 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3-(2,2,5,5-tetramethyloxolan-3-yl)pentan-2-one |
| SMILES | CCC(C(C)=O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H24O2/c1-7-10(9(2)14)11-8-12(3,4)15-13(11,5)6/h10-11H,7-8H2,1-6H3 |
| InChIKey | XOPCKMLPABQWHI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |