C12H23ClO — CID 114623946
3-(3-chlorobutan-2-yl)-2,2,5,5-tetramethyloxolane (PubChem CID 114623946) has the molecular formula C12H23ClO and a molecular weight of 218.77 g/mol. Its IUPAC name is 3-(3-chlorobutan-2-yl)-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-(3-chlorobutan-2-yl)-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 114623946 |
| Molecular Formula | C12H23ClO |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-(3-chlorobutan-2-yl)-2,2,5,5-tetramethyloxolane |
| SMILES | CC(Cl)C(C)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C12H23ClO/c1-8(9(2)13)10-7-11(3,4)14-12(10,5)6/h8-10H,7H2,1-6H3 |
| InChIKey | ALAIKTFCDPKDTL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|