C13H25BrO — CID 114624288
3-(4-bromopentan-2-yl)-2,2,5,5-tetramethyloxolane (PubChem CID 114624288) has the molecular formula C13H25BrO and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-(4-bromopentan-2-yl)-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-(4-bromopentan-2-yl)-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 114624288 |
| Molecular Formula | C13H25BrO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-(4-bromopentan-2-yl)-2,2,5,5-tetramethyloxolane |
| SMILES | CC(Br)CC(C)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H25BrO/c1-9(7-10(2)14)11-8-12(3,4)15-13(11,5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | GCTLIWBLMPINIV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|