C12H26N2O2 — CID 105247064
[2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propyl]hydrazine (PubChem CID 105247064) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propyl]hydrazine.
| Compound Name | [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105247064 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)propyl]hydrazine |
| SMILES | COC(C)C(NN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-8(15-6)10(14-13)9-7-11(2,3)16-12(9,4)5/h8-10,14H,7,13H2,1-6H3 |
| InChIKey | DHTIVYPVSNICTH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|