C16H34N2O2 — CID 105273857
[2-ethoxy-3,3-dimethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine (PubChem CID 105273857) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is [2-ethoxy-3,3-dimethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine.
| Compound Name | [2-ethoxy-3,3-dimethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105273857 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | [2-ethoxy-3,3-dimethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
| SMILES | CCOC(C(NN)C1CC(C)(C)OC1(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34N2O2/c1-9-19-13(14(2,3)4)12(18-17)11-10-15(5,6)20-16(11,7)8/h11-13,18H,9-10,17H2,1-8H3 |
| InChIKey | GCOFKTMMXACVKP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|