C15H32N2O2 — CID 105271503
[2-ethoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)pentyl]hydrazine (PubChem CID 105271503) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is [2-ethoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)pentyl]hydrazine.
| Compound Name | [2-ethoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105271503 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | [2-ethoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)pentyl]hydrazine |
| SMILES | CCCC(OCC)C(NN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H32N2O2/c1-7-9-12(18-8-2)13(17-16)11-10-14(3,4)19-15(11,5)6/h11-13,17H,7-10,16H2,1-6H3 |
| InChIKey | XMYJFEWWIVIOEF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|