C11H24N2OS — CID 105214018
[2-methylsulfanyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine (PubChem CID 105214018) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is [2-methylsulfanyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-methylsulfanyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105214018 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | [2-methylsulfanyl-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine |
| SMILES | CSCC(NN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C11H24N2OS/c1-10(2)6-8(11(3,4)14-10)9(13-12)7-15-5/h8-9,13H,6-7,12H2,1-5H3 |
| InChIKey | SJZXYMPTZCDBKC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|