C13H20N2O2 — CID 114622059
pyrimidin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol (PubChem CID 114622059) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is pyrimidin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol.
| Compound Name | pyrimidin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 114622059 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | pyrimidin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
| SMILES | CC1(C)CC(C(O)c2ccncn2)C(C)(C)O1 |
| InChI | InChI=1S/C13H20N2O2/c1-12(2)7-9(13(3,4)17-12)11(16)10-5-6-14-8-15-10/h5-6,8-9,11,16H,7H2,1-4H3 |
| InChIKey | FBAZELCKRSYNQF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |