C18H23NO2 — CID 114622205
isoquinolin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol (PubChem CID 114622205) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is isoquinolin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol.
| Compound Name | isoquinolin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 114622205 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | isoquinolin-4-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
| SMILES | CC1(C)CC(C(O)c2cncc3ccccc23)C(C)(C)O1 |
| InChI | InChI=1S/C18H23NO2/c1-17(2)9-15(18(3,4)21-17)16(20)14-11-19-10-12-7-5-6-8-13(12)14/h5-8,10-11,15-16,20H,9H2,1-4H3 |
| InChIKey | DOZAMNNFOBBNRN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |