C17H22N2O2 — CID 107357753
quinoxalin-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol (PubChem CID 107357753) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is quinoxalin-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol.
| Compound Name | quinoxalin-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 107357753 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | quinoxalin-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
| SMILES | CC1(C)CC(C(O)c2cnc3ccccc3n2)C(C)(C)O1 |
| InChI | InChI=1S/C17H22N2O2/c1-16(2)9-11(17(3,4)21-16)15(20)14-10-18-12-7-5-6-8-13(12)19-14/h5-8,10-11,15,20H,9H2,1-4H3 |
| InChIKey | SMDGYJUIHNCTAW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |