C12H14N2O4 — CID 7128813
(1R,2S,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol (PubChem CID 7128813) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1R,2S,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 7128813 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1R,2S,3R)-1-quinoxalin-2-ylbutane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H14N2O4/c15-6-10(16)12(18)11(17)9-5-13-7-3-1-2-4-8(7)14-9/h1-5,10-12,15-18H,6H2/t10-,11-,12-/m1/s1 |
| InChIKey | JNOHSLKLTQNYAD-IJLUTSLNSA-N |
| XLogP | -0.62 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |