About 2-quinoxalin-2-ylethanol
2-quinoxalin-2-ylethanol (PubChem CID 14338462) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-quinoxalin-2-ylethanol.
Molecular Properties
| Compound Name | 2-quinoxalin-2-ylethanol |
| PubChem CID | 14338462 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-quinoxalin-2-ylethanol |
| SMILES | OCCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C10H10N2O/c13-6-5-8-7-11-9-3-1-2-4-10(9)12-8/h1-4,7,13H,5-6H2 |
| InChIKey | IBGYOCWSEXZTCV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-quinoxalin-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinoxalin-2-ylethanol?
The IUPAC name of 2-quinoxalin-2-ylethanol (CID 14338462) is 2-quinoxalin-2-ylethanol.
What is the SMILES notation for 2-quinoxalin-2-ylethanol?
The canonical SMILES for 2-quinoxalin-2-ylethanol is OCCc1cnc2ccccc2n1.
What is the InChIKey of 2-quinoxalin-2-ylethanol?
The InChIKey is IBGYOCWSEXZTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c13-6-5-8-7-11-9-3-1-2-4-10(9)12-8/h1-4,7,13H,5-6H2.
What are the key properties of 2-quinoxalin-2-ylethanol?
2-quinoxalin-2-ylethanol has a molecular weight of 174.20 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinoxalin-2-ylethanol is sourced from PubChem (CID 14338462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).