C13H16BrN3O3S — CID 114625195
5-amino-4-bromo-N,2-dimethyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide (PubChem CID 114625195) has the molecular formula C13H16BrN3O3S and a molecular weight of 374.26 g/mol. Its IUPAC name is 5-amino-4-bromo-N,2-dimethyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N,2-dimethyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114625195 |
| Molecular Formula | C13H16BrN3O3S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 5-amino-4-bromo-N,2-dimethyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(CN(C)S(=O)(=O)c2cc(N)c(Br)cc2C)no1 |
| InChI | InChI=1S/C13H16BrN3O3S/c1-8-4-11(14)12(15)6-13(8)21(18,19)17(3)7-10-5-9(2)20-16-10/h4-6H,7,15H2,1-3H3 |
| InChIKey | PFUUEUCWQMVGHZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|