C13H21FN2O3S2 — CID 114626282
3-amino-N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-4-methoxybenzenesulfonamide (PubChem CID 114626282) has the molecular formula C13H21FN2O3S2 and a molecular weight of 336.45 g/mol. Its IUPAC name is 3-amino-N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-4-methoxybenzenesulfonamide.
| Compound Name | 3-amino-N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114626282 |
| Molecular Formula | C13H21FN2O3S2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-amino-N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-4-methoxybenzenesulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cc(N)c(OC)c(F)c1 |
| InChI | InChI=1S/C13H21FN2O3S2/c1-4-20-6-5-9(2)16-21(17,18)10-7-11(14)13(19-3)12(15)8-10/h7-9,16H,4-6,15H2,1-3H3 |
| InChIKey | MFOVZNGXPVZVST-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|