C13H25N3O2S — CID 114627762
N-[(4-methylmorpholin-2-yl)methyl]-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114627762) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[(4-methylmorpholin-2-yl)methyl]-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-[(4-methylmorpholin-2-yl)methyl]-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114627762 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(4-methylmorpholin-2-yl)methyl]-2-piperidin-4-ylsulfanylacetamide |
| SMILES | CN1CCOC(CNC(=O)CSC2CCNCC2)C1 |
| InChI | InChI=1S/C13H25N3O2S/c1-16-6-7-18-11(9-16)8-15-13(17)10-19-12-2-4-14-5-3-12/h11-12,14H,2-10H2,1H3,(H,15,17) |
| InChIKey | LQXVWLRTYGLRHR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |