C7H14ClNO3S — CID 114631690
1-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)methanesulfonamide (PubChem CID 114631690) has the molecular formula C7H14ClNO3S and a molecular weight of 227.71 g/mol. Its IUPAC name is 1-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)methanesulfonamide.
| Compound Name | 1-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)methanesulfonamide |
|---|---|
| PubChem CID | 114631690 |
| Molecular Formula | C7H14ClNO3S |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 1-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)methanesulfonamide |
| SMILES | CC1(C)C(O)CC1NS(=O)(=O)CCl |
| InChI | InChI=1S/C7H14ClNO3S/c1-7(2)5(3-6(7)10)9-13(11,12)4-8/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | CLBHVODAHCGQFU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|