C12H21ClN4 — CID 114631826
3-chloro-2,2-dimethyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-amine (PubChem CID 114631826) has the molecular formula C12H21ClN4 and a molecular weight of 256.78 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-amine.
| Compound Name | 3-chloro-2,2-dimethyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 114631826 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-amine |
| SMILES | CCCn1ncnc1CNC1CC(Cl)C1(C)C |
| InChI | InChI=1S/C12H21ClN4/c1-4-5-17-11(15-8-16-17)7-14-10-6-9(13)12(10,2)3/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | NIBSXWGPCNCMAW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|