C15H19BrFN3O — CID 114633372
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(4-fluorophenyl)ethanol (PubChem CID 114633372) has the molecular formula C15H19BrFN3O and a molecular weight of 356.24 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(4-fluorophenyl)ethanol.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 114633372 |
| Molecular Formula | C15H19BrFN3O |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-(4-fluorophenyl)ethanol |
| SMILES | CN(C)CCn1ncc(Br)c1C(C)(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19BrFN3O/c1-15(21,11-4-6-12(17)7-5-11)14-13(16)10-18-20(14)9-8-19(2)3/h4-7,10,21H,8-9H2,1-3H3 |
| InChIKey | SJCPANBNVJLRHO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |