C14H27BrN4O — CID 114665958
2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-4-(propylamino)butan-2-ol (PubChem CID 114665958) has the molecular formula C14H27BrN4O and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-4-(propylamino)butan-2-ol.
| Compound Name | 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-4-(propylamino)butan-2-ol |
|---|---|
| PubChem CID | 114665958 |
| Molecular Formula | C14H27BrN4O |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-4-(propylamino)butan-2-ol |
| SMILES | CCCNCCC(C)(O)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C14H27BrN4O/c1-5-7-16-8-6-14(2,20)13-12(15)11-17-19(13)10-9-18(3)4/h11,16,20H,5-10H2,1-4H3 |
| InChIKey | IMUKUZRWGNWTBG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|